Products 570391-47-8
CAS 570391-47-8 appears in our catalog under these names: N–((1,1'–Biphenyl)–4–yl)–(1,1'–biphenyl)–3–amine, N-([1,1'-Biphenyl]-4-yl)-[1,1'-biphenyl]-3-amine, >98.0%(HPLC)(N), N-([1,1'-Biphenyl]-4-yl)-[1,1'-biphenyl]-3-amine 97%, N-([1,1'-Biphenyl]-4-yl)-[1,1'-biphenyl]-3-amine, N-([1,1'-Biphenyl]-4-yl)-[1,1'-biphenyl]-3-amine, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
3-phenyl-N-(4-phenylphenyl)aniline (CAS 570391-47-8) is a chemical compound with the molecular formula C24H19N and a molecular weight of 321.4 g/mol. IUPAC name: 3-phenyl-N-(4-phenylphenyl)aniline. InChIKey: CSFNUYPFWSRMET-UHFFFAOYSA-N.
| Molecular formula | C24H19N |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 3-phenyl-N-(4-phenylphenyl)aniline |
| InChIKey | CSFNUYPFWSRMET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=CC(=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)