CAS 889750-37-2 is the registry number for 2–(9,9–Dimethyl–9H–fluoren–2–yl)quinoline. Offered by: GLPBio. Available pack sizes: 10g.
2-(9,9-dimethylfluoren-2-yl)quinoline (CAS 889750-37-2) is a chemical compound with the molecular formula C24H19N and a molecular weight of 321.4 g/mol. IUPAC name: 2-(9,9-dimethylfluoren-2-yl)quinoline. InChIKey: WHHNAXUPYPAMDD-UHFFFAOYSA-N.
| Molecular formula | C24H19N |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 2-(9,9-dimethylfluoren-2-yl)quinoline |
| InChIKey | WHHNAXUPYPAMDD-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C4=NC5=CC=CC=C5C=C4)C |
Computed by PubChem (NCBI)