CAS 25660-12-2 is the registry number for [1,1':4',1'':4'',1'''-Quaterphenyl]-4-amine 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-[4-(4-phenylphenyl)phenyl]aniline (CAS 25660-12-2) is a chemical compound with the molecular formula C24H19N and a molecular weight of 321.4 g/mol. IUPAC name: 4-[4-(4-phenylphenyl)phenyl]aniline. InChIKey: WVMMWAWDYFKKCC-UHFFFAOYSA-N.
| Molecular formula | C24H19N |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 4-[4-(4-phenylphenyl)phenyl]aniline |
| InChIKey | WVMMWAWDYFKKCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)