Products 1021535-48-7
CAS 1021535-48-7 appears in our catalog under these names: 2-(1,1-Difluoroethyl)-4-pyridinecarboxylic acid, 2-(1,1-DIFLUOROETHYL)ISONICOTINIC ACID, 98%, 2-(1,1-DIFLUOROETHYL)ISONICOTINIC ACID, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 50mg.
2-(1,1-difluoroethyl)pyridine-4-carboxylic acid (CAS 1021535-48-7) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 2-(1,1-difluoroethyl)pyridine-4-carboxylic acid. InChIKey: STNFYMLYILKETE-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 2-(1,1-difluoroethyl)pyridine-4-carboxylic acid |
| InChIKey | STNFYMLYILKETE-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=CC(=C1)C(=O)O)(F)F |
Computed by PubChem (NCBI)