CAS 1022112-22-6 appears in our catalog under these names: 1-(3-Chloropropyl)pyrrolidine oxalic acid, 95%, 1-(3-chloropropyl)pyrrolidine oxalate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
1-(3-chloropropyl)pyrrolidine;oxalic acid (CAS 1022112-22-6) is a chemical compound with the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. IUPAC name: 1-(3-chloropropyl)pyrrolidine;oxalic acid. InChIKey: CYNQUJRBWOSZQQ-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO4 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 1-(3-chloropropyl)pyrrolidine;oxalic acid |
| InChIKey | CYNQUJRBWOSZQQ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCCCl.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)