Products 1211510-61-0
CAS 1211510-61-0 appears in our catalog under these names: Dimethyl piperidine-3,5-dicarboxylate hydrochloride, 95%, Dimethyl piperidine-3,5-dicarboxylate hydrochloride, 97%, Dimethyl 3,5-piperidinedicarboxylate hydrochloride, Dimethyl piperidine-3,5-dicarboxylate hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 2,5g, 100mg.
Dimethyl piperidine-3,5-dicarboxylate;hydrochloride (CAS 1211510-61-0) is a chemical compound with the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. IUPAC name: dimethyl piperidine-3,5-dicarboxylate;hydrochloride. InChIKey: CKHNNEWIFMNBOM-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO4 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | dimethyl piperidine-3,5-dicarboxylate;hydrochloride |
| InChIKey | CKHNNEWIFMNBOM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(CNC1)C(=O)OC.Cl |
Computed by PubChem (NCBI)