CAS 1099378-04-7 appears in our catalog under these names: Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate hydrochloride, 98%, rel-(3S,5R)-Dimethyl piperidine-3,5-dicarboxylate hydrochloride, 98%, 98%, rel-(3S,5R)-Dimethyl piperidine-3,5-dicarboxylate hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Dimethyl (3S,5R)-piperidine-3,5-dicarboxylate;hydrochloride (CAS 1099378-04-7) is a chemical compound with the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. IUPAC name: dimethyl (3S,5R)-piperidine-3,5-dicarboxylate;hydrochloride. InChIKey: CKHNNEWIFMNBOM-UKMDXRBESA-N.
| Molecular formula | C9H16ClNO4 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | dimethyl (3S,5R)-piperidine-3,5-dicarboxylate;hydrochloride |
| InChIKey | CKHNNEWIFMNBOM-UKMDXRBESA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CNC1)C(=O)OC.Cl |
Computed by PubChem (NCBI)