Products 2375247-87-1
CAS 2375247-87-1 is the registry number for Methyl (2S,4R)-4-(2-methoxy-2-oxoethyl)pyrrolidine-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (2S,4R)-4-(2-methoxy-2-oxoethyl)pyrrolidine-2-carboxylate;hydrochloride (CAS 2375247-87-1) is a chemical compound with the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. IUPAC name: methyl (2S,4R)-4-(2-methoxy-2-oxoethyl)pyrrolidine-2-carboxylate;hydrochloride. InChIKey: FEGHSNMLONUTDR-HHQFNNIRSA-N.
| Molecular formula | C9H16ClNO4 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | methyl (2S,4R)-4-(2-methoxy-2-oxoethyl)pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | FEGHSNMLONUTDR-HHQFNNIRSA-N |
| SMILES | COC(=O)C[C@H]1C[C@H](NC1)C(=O)OC.Cl |
Computed by PubChem (NCBI)