CAS 1313277-91-6 is the registry number for 3-Chloro-N-((1,1-Dimethylethoxy)carbonyl)-D-Alanine Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
Methyl (2S)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1313277-91-6) is a chemical compound with the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. IUPAC name: methyl (2S)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: VAUXVOGTPPDPQC-ZCFIWIBFSA-N.
| Molecular formula | C9H16ClNO4 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | methyl (2S)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | VAUXVOGTPPDPQC-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCl)C(=O)OC |
Computed by PubChem (NCBI)