CAS 150109-42-5 appears in our catalog under these names: (S)-Chloromethyl 2-((tert-butoxycarbonyl)amino)propanoate, 95%, N–(tert–Butoxycarbonyl)–L–alanine chloromethyl ester. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg.
Chloromethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 150109-42-5) is a chemical compound with the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. IUPAC name: chloromethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: MVUAMEQSMWWVQY-LURJTMIESA-N.
| Molecular formula | C9H16ClNO4 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | chloromethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | MVUAMEQSMWWVQY-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)OCCl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)