CAS 150109-41-4 appears in our catalog under these names: 3-tert-Butoxycarbonylamino-propionic acid chloromethyl ester, 95%, Chloromethyl 3-((tert-butoxycarbonyl)amino)propanoate 95%, 3-tert-Butoxycarbonylamino-propionic acid chloromethyl ester, 95%, 95%, Chloromethyl 3-((tert-butoxycarbonyl)amino)propanoate, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 25g.
Chloromethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 150109-41-4) is a chemical compound with the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. IUPAC name: chloromethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: WONDONZVEYHOOG-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO4 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | chloromethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | WONDONZVEYHOOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)OCCl |
Computed by PubChem (NCBI)