CAS 10222-86-3 is the registry number for 3,5-Diphenyl-4H-pyrazole, 97%. Offered by: AmBeed. Available pack sizes: 25g.
3,5-diphenyl-4H-pyrazole (CAS 10222-86-3) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 3,5-diphenyl-4H-pyrazole. InChIKey: NSFLJLJINCMQEC-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 3,5-diphenyl-4H-pyrazole |
| InChIKey | NSFLJLJINCMQEC-UHFFFAOYSA-N |
| SMILES | C1C(=NN=C1C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)