CAS 1093344-99-0 is the registry number for Methyl 2,3,5-tri-O-benzoyl-b-D-arabinofuranoside. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.
[(2R,3S,5R)-3,4-dibenzoyloxy-5-methoxyoxolan-2-yl]methyl benzoate (CAS 1093344-99-0) is a chemical compound with the molecular formula C27H24O8 and a molecular weight of 476.5 g/mol. IUPAC name: [(2R,3S,5R)-3,4-dibenzoyloxy-5-methoxyoxolan-2-yl]methyl benzoate. InChIKey: XJKNQPQTQXKNOC-OTRLAHFASA-N.
| Molecular formula | C27H24O8 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | [(2R,3S,5R)-3,4-dibenzoyloxy-5-methoxyoxolan-2-yl]methyl benzoate |
| InChIKey | XJKNQPQTQXKNOC-OTRLAHFASA-N |
| SMILES | CO[C@H]1C([C@H]([C@H](O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)