Products 1022589-85-0
CAS 1022589-85-0 is the registry number for 2-(4-(((1,3-dioxoindan-2-ylidene)ethyl)amino)phenyl)ethanenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[4-[1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]phenyl]acetonitrile (CAS 1022589-85-0) is a chemical compound with the molecular formula C19H14N2O2 and a molecular weight of 302.3 g/mol. IUPAC name: 2-[4-[1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]phenyl]acetonitrile. InChIKey: UYIUBRNNWMWVOI-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 2-[4-[1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]phenyl]acetonitrile |
| InChIKey | UYIUBRNNWMWVOI-UHFFFAOYSA-N |
| SMILES | CC(=NC1=CC=C(C=C1)CC#N)C2=C(C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)