CAS 71653-61-7 is the registry number for 2-Dibenzoylaminopyridin, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-benzoyl-N-pyridin-2-ylbenzamide (CAS 71653-61-7) is a chemical compound with the molecular formula C19H14N2O2 and a molecular weight of 302.3 g/mol. IUPAC name: N-benzoyl-N-pyridin-2-ylbenzamide. InChIKey: ODIQNYPEBUGOIO-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | N-benzoyl-N-pyridin-2-ylbenzamide |
| InChIKey | ODIQNYPEBUGOIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N(C2=CC=CC=N2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)