CAS 1024056-73-2 is the registry number for 3-((5-Methylisoxazol-3-yl)amino)-2-phenylinden-1-one. Offered by: Biosynth. Available pack sizes: 5000mg.
3-[(5-methyl-1,2-oxazol-3-yl)amino]-2-phenylinden-1-one (CAS 1024056-73-2) is a chemical compound with the molecular formula C19H14N2O2 and a molecular weight of 302.3 g/mol. IUPAC name: 3-[(5-methyl-1,2-oxazol-3-yl)amino]-2-phenylinden-1-one. InChIKey: OOBYKCZRFXJFAX-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 3-[(5-methyl-1,2-oxazol-3-yl)amino]-2-phenylinden-1-one |
| InChIKey | OOBYKCZRFXJFAX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC2=C(C(=O)C3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)