Products 1022983-51-2
CAS 1022983-51-2 appears in our catalog under these names: 4-Bromo-5-iodo-2-methylbenzoic acid, 97%, 4-Bromo-5-iodo-2-methyl-benzoic acid, 96%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 25g, 5g, 10g, 250mg, 1g.
4-bromo-5-iodo-2-methylbenzoic acid (CAS 1022983-51-2) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: 4-bromo-5-iodo-2-methylbenzoic acid. InChIKey: RVWSYPOXDJYFAQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | 4-bromo-5-iodo-2-methylbenzoic acid |
| InChIKey | RVWSYPOXDJYFAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)I)Br |
Computed by PubChem (NCBI)