Products 1023498-30-7
CAS 1023498-30-7 is the registry number for 2-(4-chloro-2,3-dimethylphenoxy)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-chloro-2,3-dimethylphenoxy)acetamide (CAS 1023498-30-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 2-(4-chloro-2,3-dimethylphenoxy)acetamide. InChIKey: UEQXPXMXTFWBJK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-(4-chloro-2,3-dimethylphenoxy)acetamide |
| InChIKey | UEQXPXMXTFWBJK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)Cl)OCC(=O)N |
Computed by PubChem (NCBI)