Products 102359-00-2
CAS 102359-00-2 appears in our catalog under these names: 2-Oxoindoline-5-carboxylic acid, 95%, 2-Oxoindoline-5-carboxylic Acid, 95%, 95%, 5-Carboxyoxindole, 5-Carboxyoxindole 95%. Offered by: Fluorochem, Chemat, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100mg, 250mg.
2-oxo-1,3-dihydroindole-5-carboxylic acid (CAS 102359-00-2) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-oxo-1,3-dihydroindole-5-carboxylic acid. InChIKey: LLLKBUWXODIMEW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-oxo-1,3-dihydroindole-5-carboxylic acid |
| InChIKey | LLLKBUWXODIMEW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C(=O)O)NC1=O |
Computed by PubChem (NCBI)