Products 1909312-36-2
CAS 1909312-36-2 appears in our catalog under these names: 1-Benzyl-1,6-diazaspiro(3.3)heptane dihydrochloride, 95%, 1-Benzyl-1,6-diazaspiro(3.3)heptane dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-benzyl-1,6-diazaspiro[3.3]heptane;dihydrochloride (CAS 1909312-36-2) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: 1-benzyl-1,6-diazaspiro[3.3]heptane;dihydrochloride. InChIKey: CYJWCHRVHNYMEM-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | 1-benzyl-1,6-diazaspiro[3.3]heptane;dihydrochloride |
| InChIKey | CYJWCHRVHNYMEM-UHFFFAOYSA-N |
| SMILES | C1CN(C12CNC2)CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)