CAS 5315-02-6 appears in our catalog under these names: (R)-1,3,4,6,7,11b-Hexahydro-2H-pyrazino(2,1-a)isoquinoline dihydrochloride, 95%, (R)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline dihydrochloride, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride (CAS 5315-02-6) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: (11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride. InChIKey: WPASCARMJJLMHJ-LTCKWSDVSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | (11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride |
| InChIKey | WPASCARMJJLMHJ-LTCKWSDVSA-N |
| SMILES | C1CN2CCNC[C@H]2C3=CC=CC=C31.Cl.Cl |
Computed by PubChem (NCBI)