Products 10242-01-0
CAS 10242-01-0 appears in our catalog under these names: 5-Methoxy-Indole-3-Carboxylic Acid, 5–Methoxyindole–3–carboxylic Acid, 5-Methoxyindole-3-carboxylic Acid, >98.0%(HPLC)(T), 5-Methoxy-1H-indole-3-carboxylic acid 98%, 5-methoxy-1H-indole-3-carboxylic acid, 98%, 98%. Offered by: Chemat Brand, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: on request, 1g, 5g, 250mg, 25g, 100g, 10g.
5-methoxy-1H-indole-3-carboxylic acid (CAS 10242-01-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 5-methoxy-1H-indole-3-carboxylic acid. InChIKey: RVVSEZGJCOAUED-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 5-methoxy-1H-indole-3-carboxylic acid |
| InChIKey | RVVSEZGJCOAUED-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C2C(=O)O |
Computed by PubChem (NCBI)