CAS 1026026-77-6 is the registry number for ((4-nitrophenyl)amino)(prop-2-ynylamino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-nitrophenyl)-3-prop-2-ynylthiourea (CAS 1026026-77-6) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: 1-(4-nitrophenyl)-3-prop-2-ynylthiourea. InChIKey: RQMOUGAVNFBSIC-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-3-prop-2-ynylthiourea |
| InChIKey | RQMOUGAVNFBSIC-UHFFFAOYSA-N |
| SMILES | C#CCNC(=S)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)