Products 1026471-88-4

CAS 1026471-88-4 is the registry number for m-Loxoprofen. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.

2-[3-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid (CAS 1026471-88-4) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: 2-[3-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid. InChIKey: RRAGHLHBJAIJJG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18O3
Molecular weight246.30 g/mol
IUPAC name2-[3-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid
InChIKeyRRAGHLHBJAIJJG-UHFFFAOYSA-N
SMILESCC(C1=CC=CC(=C1)CC2CCCC2=O)C(=O)O

Computed by PubChem (NCBI)