CAS 2199500-18-8 is the registry number for rel-Benzyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-benzyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate (CAS 2199500-18-8) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: trans-benzyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate. InChIKey: XDRFKYLHLWMWQU-AAEUAGOBSA-N.
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | trans-benzyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate |
| InChIKey | XDRFKYLHLWMWQU-AAEUAGOBSA-N |
| SMILES | C[C@H]1C[C@@H](CC(=O)C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)