CAS 10268-70-9 appears in our catalog under these names: Phenyl 4-aminobenzoate, 95%, Phenyl 4-aminobenzoate, 95+%, Phenyl 4-aminobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 50g.
Phenyl 4-aminobenzoate (CAS 10268-70-9) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: phenyl 4-aminobenzoate. InChIKey: HGRXBNZHQKXDPL-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | phenyl 4-aminobenzoate |
| InChIKey | HGRXBNZHQKXDPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)