CAS 1026873-92-6 is the registry number for 6,7-Dichloroquinolin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloroquinolin-3-ol (CAS 1026873-92-6) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 6,7-dichloroquinolin-3-ol. InChIKey: ZJUQLUHBWAGLQZ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 6,7-dichloroquinolin-3-ol |
| InChIKey | ZJUQLUHBWAGLQZ-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=CC2=NC=C1O)Cl)Cl |
Computed by PubChem (NCBI)