Products 102767-61-3

CAS 102767-61-3 is the registry number for 2,3-Bis((E)-4-hydroxy-3-methoxybenzylidene)succinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2E,3E)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methylidene]butanedioic acid (CAS 102767-61-3) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: (2E,3E)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methylidene]butanedioic acid. InChIKey: SPKZMOSDXTYXLK-FNCQTZNRSA-N.

Identity
Molecular formulaC20H18O8
Molecular weight386.4 g/mol
IUPAC name(2E,3E)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methylidene]butanedioic acid
InChIKeySPKZMOSDXTYXLK-FNCQTZNRSA-N
SMILESCOC1=C(C=CC(=C1)/C=C(/C(=O)O)\C(=C/C2=CC(=C(C=C2)O)OC)\C(=O)O)O

Computed by PubChem (NCBI)