Products 147711-15-7
CAS 147711-15-7 is the registry number for rac-Hesperetin 3’,5-Diacetate. Offered by: TRC. Available pack sizes: 50mg.
[2-(3-acetyloxy-4-methoxyphenyl)-7-hydroxy-4-oxo-2,3-dihydrochromen-5-yl] acetate (CAS 147711-15-7) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: [2-(3-acetyloxy-4-methoxyphenyl)-7-hydroxy-4-oxo-2,3-dihydrochromen-5-yl] acetate. InChIKey: PPZQNMKLQDFNHE-UHFFFAOYSA-N.
| Molecular formula | C20H18O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | [2-(3-acetyloxy-4-methoxyphenyl)-7-hydroxy-4-oxo-2,3-dihydrochromen-5-yl] acetate |
| InChIKey | PPZQNMKLQDFNHE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC2=C1C(=O)CC(O2)C3=CC(=C(C=C3)OC)OC(=O)C)O |
Computed by PubChem (NCBI)