Products 69638-07-9

CAS 69638-07-9 is the registry number for Hexanedioic Acid Bis-(2-carboxyphenyl) Ester. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

2-[6-(2-carboxyphenoxy)-6-oxohexanoyl]oxybenzoic acid (CAS 69638-07-9) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: 2-[6-(2-carboxyphenoxy)-6-oxohexanoyl]oxybenzoic acid. InChIKey: IRDOHKKFMUGWDT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18O8
Molecular weight386.4 g/mol
IUPAC name2-[6-(2-carboxyphenoxy)-6-oxohexanoyl]oxybenzoic acid
InChIKeyIRDOHKKFMUGWDT-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)OC(=O)CCCCC(=O)OC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)