Products 1308286-11-4
CAS 1308286-11-4 appears in our catalog under these names: (2R,3S)-2,3-Bis(4-methylbenzoyloxy)butanedioic acid, (2R,3S)-rel-2,3-Bis((4-methylbenzoyl)oxy)-butanedioic Acid. Offered by: Biosynth, TRC. Available pack sizes: 0,1g, 2,5g.
(2R,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid (CAS 1308286-11-4) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: (2R,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid. InChIKey: CMIBUZBMZCBCAT-IYBDPMFKSA-N.
| Molecular formula | C20H18O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (2R,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid |
| InChIKey | CMIBUZBMZCBCAT-IYBDPMFKSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]([C@@H](C(=O)O)OC(=O)C2=CC=C(C=C2)C)C(=O)O |
Computed by PubChem (NCBI)