CAS 203191-10-0 appears in our catalog under these names: Recoflavone, Recoflavone, 98%, 98%, Recoflavone, 98.0%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 10mM (in 1ml dmso), 10mg, 50mg, 100mg, 10mM/1mL, 100 mg.
2-[2-(3,4-dimethoxyphenyl)-5-methoxy-4-oxochromen-7-yl]oxyacetic acid (CAS 203191-10-0) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: 2-[2-(3,4-dimethoxyphenyl)-5-methoxy-4-oxochromen-7-yl]oxyacetic acid. InChIKey: BCPQOBQIVJZOFL-UHFFFAOYSA-N.
| Molecular formula | C20H18O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 2-[2-(3,4-dimethoxyphenyl)-5-methoxy-4-oxochromen-7-yl]oxyacetic acid |
| InChIKey | BCPQOBQIVJZOFL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC)OCC(=O)O)OC |
Computed by PubChem (NCBI)