CAS 102871-93-2 is the registry number for 2-Ethoxy-4-methyl-1-nitrobenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-ethoxy-4-methyl-1-nitrobenzene (CAS 102871-93-2) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-ethoxy-4-methyl-1-nitrobenzene. InChIKey: XHSBXROPHBVKIB-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-ethoxy-4-methyl-1-nitrobenzene |
| InChIKey | XHSBXROPHBVKIB-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)