Products 102879-57-2
CAS 102879-57-2 appears in our catalog under these names: 4-Methoxy-2-(methylamino)benzoic acid, 98%, 4-Methoxy-2-(methylamino)benzoic acid, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methoxy-2-(methylamino)benzoic acid (CAS 102879-57-2) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 4-methoxy-2-(methylamino)benzoic acid. InChIKey: JYHABDVIKUYXFG-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 4-methoxy-2-(methylamino)benzoic acid |
| InChIKey | JYHABDVIKUYXFG-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1)OC)C(=O)O |
Computed by PubChem (NCBI)