Products 1029120-37-3
CAS 1029120-37-3 is the registry number for 4-Hydroxyphenylacetylglutamic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[2-(4-hydroxyphenyl)acetyl]amino]pentanedioic acid (CAS 1029120-37-3) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2S)-2-[[2-(4-hydroxyphenyl)acetyl]amino]pentanedioic acid. InChIKey: CYRKYXZJUIBBJX-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S)-2-[[2-(4-hydroxyphenyl)acetyl]amino]pentanedioic acid |
| InChIKey | CYRKYXZJUIBBJX-JTQLQIEISA-N |
| SMILES | C1=CC(=CC=C1CC(=O)N[C@@H](CCC(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)