CAS 1029653-69-7 appears in our catalog under these names: 2-(4-Fluorophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane, 95%, 2-(4-Fluorophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane 95%. Offered by: Combi-blocks, Chemat Brand, Ambeed. Available pack sizes: 5g, 1g, 250mg.
2-(4-fluorophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane (CAS 1029653-69-7) is a chemical compound with the molecular formula C12H16BFO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2-(4-fluorophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane. InChIKey: ARFOLXGRXVAHCE-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
| InChIKey | ARFOLXGRXVAHCE-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)