CAS 876062-39-4 appears in our catalog under these names: 2–(2–Fluorophenyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 2-(2-Fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC)(T), 2-(2-Fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-FLUOROPHENYLBORONIC ACID, PINACOL ESTER, 97%, 97%, 2-FLUOROPHENYLBORONIC ACID, PINACOL ESTER, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100g, 500g.
2-(2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 876062-39-4) is a chemical compound with the molecular formula C12H16BFO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2-(2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RZYXBJMVAFMMLQ-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RZYXBJMVAFMMLQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2F |
Computed by PubChem (NCBI)