CAS 936618-92-7 appears in our catalog under these names: 3–Fluorophenylboronic acid pinacol ester, 2-(3-Fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-(3-Fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(3-Fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(3-Fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 250mg, 10g.
2-(3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 936618-92-7) is a chemical compound with the molecular formula C12H16BFO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2-(3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VWBPPYBBVMPZOZ-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VWBPPYBBVMPZOZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)