CAS 2231089-39-5 appears in our catalog under these names: 2-(4-Fluoro-2-methylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane 95%, 2-(4-Fluoro-2-methylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95%, 95%, 2-(4-Fluoro-2-methylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
2-(4-fluoro-2-methylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 2231089-39-5) is a chemical compound with the molecular formula C12H16BFO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2-(4-fluoro-2-methylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: LTQNHCLISVLOTB-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2-(4-fluoro-2-methylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | LTQNHCLISVLOTB-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=C(C=C2)F)C |
Computed by PubChem (NCBI)