CAS 214360-58-4 appears in our catalog under these names: 4–Fluorophenylboronic acid pinacol ester, 2-(4-Fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-(4-Fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC)(T), 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)fluorobenzene, 97%. Offered by: GLPBio, Ambeed, TCI, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 500g, 10g.
2-(4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 214360-58-4) is a chemical compound with the molecular formula C12H16BFO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2-(4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SBWKQMCGTSWDPE-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SBWKQMCGTSWDPE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)