Products 2225175-07-3
CAS 2225175-07-3 appears in our catalog under these names: 2–Fluoro–5–(cyclohexyl)phenylboronic acid, (5-Cyclohexyl-2-fluorophenyl)boronic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 25mg, 5mg, 100mg, 250mg.
(5-cyclohexyl-2-fluorophenyl)boronic acid (CAS 2225175-07-3) is a chemical compound with the molecular formula C12H16BFO2 and a molecular weight of 222.07 g/mol. IUPAC name: (5-cyclohexyl-2-fluorophenyl)boronic acid. InChIKey: WQAOFFUMFPIWIQ-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | (5-cyclohexyl-2-fluorophenyl)boronic acid |
| InChIKey | WQAOFFUMFPIWIQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2CCCCC2)F)(O)O |
Computed by PubChem (NCBI)