CAS 2225179-99-5 is the registry number for 2–Fluoro–4–(cyclohexyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(4-cyclohexyl-2-fluorophenyl)boronic acid (CAS 2225179-99-5) is a chemical compound with the molecular formula C12H16BFO2 and a molecular weight of 222.07 g/mol. IUPAC name: (4-cyclohexyl-2-fluorophenyl)boronic acid. InChIKey: MCOFPMZHBSBDRA-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | (4-cyclohexyl-2-fluorophenyl)boronic acid |
| InChIKey | MCOFPMZHBSBDRA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2CCCCC2)F)(O)O |
Computed by PubChem (NCBI)