Products 1029691-25-5
CAS 1029691-25-5 is the registry number for tert-Butyl (S)-(7-cyano-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S)-7-cyano-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl]carbamate (CAS 1029691-25-5) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: tert-butyl N-[(2S)-7-cyano-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl]carbamate. InChIKey: WQCGDEQLNYULRY-NSHDSACASA-N.
| Molecular formula | C17H19N3O2 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | tert-butyl N-[(2S)-7-cyano-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl]carbamate |
| InChIKey | WQCGDEQLNYULRY-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC2=C(C1)NC3=C2C=C(C=C3)C#N |
Computed by PubChem (NCBI)