CAS 16155-08-1 is the registry number for 1-Benzyl-4-(4-nitrophenyl)piperazine, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
1-benzyl-4-(4-nitrophenyl)piperazine (CAS 16155-08-1) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: 1-benzyl-4-(4-nitrophenyl)piperazine. InChIKey: NKULTGZUGOISIZ-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O2 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 1-benzyl-4-(4-nitrophenyl)piperazine |
| InChIKey | NKULTGZUGOISIZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)