CAS 306953-58-2 appears in our catalog under these names: 4-[[(4-Phenyl-1-piperazinyl)imino]methyl]-1,3-benzenediol, 95%, 4-[[(4-Phenyl-1-piperazinyl)imino]methyl]-1,3-benzenediol, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-[(E)-(4-phenylpiperazin-1-yl)iminomethyl]benzene-1,3-diol (CAS 306953-58-2) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: 4-[(E)-(4-phenylpiperazin-1-yl)iminomethyl]benzene-1,3-diol. InChIKey: YWMXWXLJJAEYIR-QGOAFFKASA-N.
| Molecular formula | C17H19N3O2 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 4-[(E)-(4-phenylpiperazin-1-yl)iminomethyl]benzene-1,3-diol |
| InChIKey | YWMXWXLJJAEYIR-QGOAFFKASA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2)/N=C/C3=C(C=C(C=C3)O)O |
Computed by PubChem (NCBI)