Products 346721-14-0
CAS 346721-14-0 is the registry number for N'-(1-(3-Aminophenyl)ethylidene)-2-(4-methoxyphenyl)acetohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(E)-1-(3-aminophenyl)ethylideneamino]-2-(4-methoxyphenyl)acetamide (CAS 346721-14-0) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: N-[(E)-1-(3-aminophenyl)ethylideneamino]-2-(4-methoxyphenyl)acetamide. InChIKey: SNRFKHJHQATIFQ-XDHOZWIPSA-N.
| Molecular formula | C17H19N3O2 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | N-[(E)-1-(3-aminophenyl)ethylideneamino]-2-(4-methoxyphenyl)acetamide |
| InChIKey | SNRFKHJHQATIFQ-XDHOZWIPSA-N |
| SMILES | C/C(=N\NC(=O)CC1=CC=C(C=C1)OC)/C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)