CAS 61338-13-4 appears in our catalog under these names: Mirtazapine Impurity 6, 1-(3-Carboxy-2-pyridyl)-4-methyl-2-phenylpiperazine, >95% (HPLC), 2-(4-Methyl-2-phenylpiperazin-1-yl)pyridine-3-carboxylic Acid, 2–(4–Methyl–2–phenylpiperazin–1–yl)nicotinic acid, Mirtazapine carboxylic acid 97%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 2,5mg, 25mg, 50mg, 100mg, 1g, 250mg, 5g.
2-(4-methyl-2-phenylpiperazin-1-yl)pyridine-3-carboxylic acid (CAS 61338-13-4) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: 2-(4-methyl-2-phenylpiperazin-1-yl)pyridine-3-carboxylic acid. InChIKey: HCVDLMUVEGPGGH-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O2 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 2-(4-methyl-2-phenylpiperazin-1-yl)pyridine-3-carboxylic acid |
| InChIKey | HCVDLMUVEGPGGH-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(C1)C2=CC=CC=C2)C3=C(C=CC=N3)C(=O)O |
Computed by PubChem (NCBI)