Products 886360-80-1

CAS 886360-80-1 is the registry number for 6-(4-Benzylpiperazino)nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-(4-benzylpiperazin-1-yl)pyridine-3-carboxylic acid (CAS 886360-80-1) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: 6-(4-benzylpiperazin-1-yl)pyridine-3-carboxylic acid. InChIKey: QBGFOAVNQHUNFD-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19N3O2
Molecular weight297.35 g/mol
IUPAC name6-(4-benzylpiperazin-1-yl)pyridine-3-carboxylic acid
InChIKeyQBGFOAVNQHUNFD-UHFFFAOYSA-N
SMILESC1CN(CCN1CC2=CC=CC=C2)C3=NC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)