Products 1395493-09-0

CAS 1395493-09-0 is the registry number for 2-Phenyl-5,7-dihydro-pyrrolo[3,4-d]pyrimidine-6-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (CAS 1395493-09-0) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: tert-butyl 2-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate. InChIKey: OGDDFHIGIAKGMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19N3O2
Molecular weight297.35 g/mol
IUPAC nametert-butyl 2-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate
InChIKeyOGDDFHIGIAKGMJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2=CN=C(N=C2C1)C3=CC=CC=C3

Computed by PubChem (NCBI)