Products 1029714-95-1
CAS 1029714-95-1 appears in our catalog under these names: 4-Acetyl-2-fluorobenzoic acid, 95%, 4-Acetyl-2-fluorobenzoic acid, 97%, 4-Acetyl-2-fluorobenzoic Acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,1g, 0,05g, 0,25g, 0,5g.
4-acetyl-2-fluorobenzoic acid (CAS 1029714-95-1) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 4-acetyl-2-fluorobenzoic acid. InChIKey: VLZOECVDUSVHBH-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 4-acetyl-2-fluorobenzoic acid |
| InChIKey | VLZOECVDUSVHBH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)